Ritalinic acid
Ritalinic acid (α-phenylpiperidine-2-acetic acid) is a substituted phenethylamine and an inactive major metabolite of the psychostimulant drugs methylphenidate. Ritalinic acid can be biodegraded and used as a sole carbon and nitrogen source by various microbial strains originating from different environmental samples.
Trivial name | α-phenylpiperidine-2-acetic acid |
Catalog Number | S5251 |
Molecular Formula | C13H17NO2 |
CAS# | 19395-41-6 |
SMILES | C1CCNC(C1)C(C2=CC=CC=C2)C(=O)O |
Size | 5mg |
Supplier Page | http://www.selleckchem.com/products/ritalinic-acid.html |
Additional Information | https://file.selleck.cn/downloads/struct/s5251-ritalinic-acid-chemical-structure.gif |