APS-5
APS-5 is a chemiluminescent substrate based on 9, 10-dihydroacridine, which is mainly used for ELISA detection of alkaline phosphatase AP conjugated compounds and for the diagnosis of immune detection, such as tumor markers, infectious diseases, endocrine function, hormones, etc.
Catalog Number | PIPB-0488 |
Alternative Name(s) | Lumigen APS-5 Sodium ((4-chlorophenyl)thio)(10-methylacridin-9(10H)-ylidene)methyl phosphate disodium;[(4-chlorophenyl)sulfanyl-(10-methylacridin-9-ylidene)methyl] phosphate Sodium [(4-Chlorophenyl)thio][10-methylacridin-9(10H)-ylidene]methyl Phosphate |
Research Area | In Vitro Diagnostics Reagents |
Molecular Formula | C21H15ClNNa2O4PS |
CAS# | 193884-53-6 |
SMILES | CN1C2=CC=CC=C2C(=C(OP(=O)([O-])[O-])SC3=CC=C(C=C3)Cl)C4=CC=CC=C41.[Na+].[Na+] |
Size | inquiry |
Supplier Page | https://www.protheragen-ing.com/aps-5-item-10606.html |