BRL-15572 2HCl
BRL-15572 2HCl is a selective h5-HT1D antagonist, displaying 60-fold selectivity over h5-HT1B and exhibiting little or no affinity for a range of other receptor types.
| Trivial name | / |
| Catalog Number | CSN10484 |
| Alternative Name(s) | / |
| Research Area | Neurological Disease |
| Molecular Formula | C25H29Cl3N2O |
| CAS# | 193611-72-2 |
| Purity | ≥99% |
| SMILES | OC(CN1CCN(C2=CC=CC(Cl)=C2)CC1)C(C3=CC=CC=C3)C4=CC=CC=C4.[H]Cl.[H]Cl |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/brl-15572-2hcl.html |