BRL-15572 10mM * 1mL in DMSO
BRL-15572 is a selective h5-HT1D antagonist, displaying 60-fold selectivity over h5-HT1B, and exhibiting little or no affinity for a range of other receptor types.
| Trivial name | BRL-15572 10mM * 1mL in DMSO |
| Catalog Number | A11178-10mM-D |
| Alternative Name(s) | 3-[4-(4-Chlorophenyl)piperazin-1-yl ]-1,1-diphenyl-2-propanol hydrochloride |
| Molecular Formula | C25H27ClN2O.HCl |
| CAS# | 193611-72-2 |
| SMILES | C1CN(CCN1CC(C(C2=CC=CC=C2)C3=CC=CC=C3)O)C4=CC(=CC=C4)Cl.Cl.Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/brl-15572.html |
