Semixylenol orange | MedChemExpress (MCE)
Semixylenol orange is a metallochromic indicator that can complex with various metal ions and is used for the testing and analysis of metal ions such as zinc and zirconium[1][2].
| Trivial name | Semixylenol orange |
| Catalog Number | HY-W134020 |
| Alternative Name(s) | Semixylenol orange |
| Research Area | Others |
| CAS# | 19329-67-0 |
| Purity | ≥98.0% |
| SMILES | O=C(CN(CC1=C(O)C(C)=CC(C2(C3=CC=C(C(C)=C3)O)OS(=O)(C4=C2C=CC=C4)=O)=C1)CC(O)=O)O |
| Size | 25 g |
| Supplier Page | https://www.medchemexpress.com/semixylenol-orange.html |