Semixylenol orange | MedChemExpress (MCE)
Semixylenol orange is a metallochromic indicator that can complex with various metal ions and is used for the testing and analysis of metal ions such as zinc and zirconium[1][2].

Trivial name | Semixylenol orange |
Catalog Number | HY-W134020 |
Alternative Name(s) | Semixylenol orange |
Research Area | Others |
CAS# | 19329-67-0 |
Purity | ≥98.0% |
SMILES | O=C(CN(CC1=C(O)C(C)=CC(C2(C3=CC=C(C(C)=C3)O)OS(=O)(C4=C2C=CC=C4)=O)=C1)CC(O)=O)O |
Size | 25 g |
Supplier Page | https://www.medchemexpress.com/semixylenol-orange.html |