Lactyl-CoA | MedChemExpress (MCE)
Lactyl-CoA is an acyl-CoA formally condensed from the sulfhydryl group of CoA and the carboxyl group of lactic acid, also known as lactyl-CoA. Lactyl-CoA is essential for the biosynthesis of biodegradable and biocompatible lactic acid-based copolymers[1].
Trivial name | Lactyl-CoA |
Catalog Number | HY-141540 |
Research Area | Others |
CAS# | 1926-57-4 |
Purity | ≥98.00% |
SMILES | O[C@H]1[C@](O[C@@H]([C@H]1OP(O)(O)=O)COP(OP(OCC(C)(C)[C@@H](O)C(NCCC(NCCSC(C(O)C)=O)=O)=O)(O)=O)(O)=O)([H])N2C3=NC=NC(N)=C3N=C2 |
PubChem Chemical Structure ID | 3081970 |
Size | 1 mg |
Supplier Page | https://www.medchemexpress.com/lactyl-coa.html |