Lomeguatrib
Lomeguatrib, an inhibitor of DNA repair protein O(6)-methylguanine-DNA methyltransferase (MGMT) with IC50 of 0.009 μM in cell-free extracts from HeLa S3 cells, is a modified guanine base.
| Trivial name | PaTrin-2 |
| Catalog Number | CSN15937 |
| Alternative Name(s) | PaTrin-2 |
| Research Area | Cancer |
| Molecular Formula | C10H8BrN5OS |
| CAS# | 192441-08-0 |
| Purity | ≥99% |
| SMILES | NC1=NC(OCC2=CC(Br)=CS2)=C3N=CNC3=N1 |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/lomeguatrib.html |
