Tipifarnib (Zarnestra) 10mM * 1mL in DMSO
Tipifarnib (Zarnestra) is a farnesyltransferase inhibitor that inhibits the Ras kinase in a post translational modification step before the kinase pathway becomes hyperactive.
Trivial name | Tipifarnib (Zarnestra) 10mM * 1mL in DMSO |
Catalog Number | A10935-10mM-D |
Alternative Name(s) | 6-[amino(4-chlorophenyl)(1-methyl-1H-imidazol-5-yl)methyl]-4-(3-chlorophenyl)-1-methylquinolin-2(1H)-one |
Molecular Formula | C27H22Cl2N4O |
CAS# | 192185-72-1 |
SMILES | CN1C=NC=C1[C@@](C2=CC=C(C=C2)Cl)(C3=CC4=C(C=C3)N(C(=O)C=C4C5=CC(=CC=C5)Cl)C)N |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/tipifarnib-zarnestra.html |