Lenalidomide
Lenalidomide is a potent inhibitor of TNF-α that, at 10 μM, alters gene expression and cell viability in a range of cancer cell lines.
| Catalog Number | T1642 |
| Alternative Name(s) | CC-5013 |
| Research Area | Apoptosis|||PROTAC |
| Molecular Formula | C13H13N3O3 |
| CAS# | 191732-72-6 |
| Purity | 99.52% |
| SMILES | Nc1cccc2C(=O)N(Cc12)C1CCC(=O)NC1=O |
| Size | 500 mg |
| Supplier Page | https://www.targetmol.com/compound/Lenalidomide |
| Additional Information | https://www.targetmol.com/datasheet/T1642 |
