Atrazine
Agro Chemicals
| Trivial name | NULL |
| Catalog Number | CS-T-04373 |
| Alternative Name(s) | 6-chloro-N2-ethyl-N4-isopropyl-1,3,5-triazine-2,4-diamine |
| Research Area | Selective herbicide. Potential symptoms of overexposure are irritation of eyes and skin; dermatitis, skin sensitization; dyspnea, weakness, incoordination, salivation; hypothermia; liver injury. |
| Molecular Formula | C8H14ClN5 |
| CAS# | 1912-24-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC(C)NC1=[15N]C(Cl)=[15N]C(NCC)=[15N]1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST04373.html |
| Additional Information | NULL |