Gracillin
Gracillin is a kind of steroidal saponin isolated and purified from the roots of Dioscorea opposita Thunb. and the root bark of wild yam Dioscorea nipponica with antitumor agent.
| Trivial name | / |
| Catalog Number | CSN13978 |
| Alternative Name(s) | / |
| Research Area | Cancer |
| Molecular Formula | C45H72O17 |
| CAS# | 19083-00-2 |
| Purity | ≥99% |
| SMILES | C[C@@]12[C@]([C@@H]3C)([H])[C@](O[C@]34CC[C@@H](C)CO4)([H])C[C@@]1([H])[C@@](CC=C5[C@@]6(CC[C@H](O[C@@](O[C@H](CO)[C@@H](O)[C@@H]7O[C@]([C@@H]([C@@H](O)[C@@H]8O)O)([H])O[C@@H]8CO)([H])[C@@H]7O[C@@](O[C@@H](C)[C@H](O)[C@H]9O)([H])[C@@H]9O)C5)C)([H])[C@]6([H])CC2 |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/gracillin.html |
