Bepotastine Besilate
Non-sedating, selective antagonist of histamine 1 (H1) receptor Neuroscience|Histamine Receptor
| Catalog Number | B1569-200 |
| Research Area | Neuroscience|Histamine Receptor |
| Molecular Formula | C27H31ClN2O6S |
| CAS# | 190786-44-8 |
| Purity | 99.71% |
| SMILES | C1CN(CCC1OC(C2=CC=C(C=C2)Cl)C3=CC=CC=N3)CCCC(=O)O.C1=CC=C(C=C1)S(=O)(=O)O |
| Size | 200mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B1569 |
