Dioscin 100mg
Dioscin (Collettiside III) is extracted and isolated from Polygonatum Zanlanscianense Pamp with IC50 of 2.6, 0.8, 7.5, and 4.5 ??M for the inhibition of the growth of the MDA-MB-435, H14, HL60, and HeLa cell lines, respectively.
| Trivial name | Dioscin 100mg |
| Catalog Number | A10314-100 |
| Alternative Name(s) | Diosgenin bis-alpha-L-rhamnopyranosyl)-(1-2 and 1-4)-beta-D-glucopyranoside |
| Molecular Formula | C45H72O16 |
| CAS# | 19057-60-4 |
| SMILES | C[C@@H]1CC[C@@]2([C@H]([C@H]3[C@@H](O2)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4CC=C6[C@@]5(CC[C@@H](C6)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O[C@H]8[C@@H]([C@@H]([C@H]([C@@H](O8)C)O)O)O)O)O[C@H]9[C@@H]([C@@H]([C@H]([C@@H](O9)C)O)O)O)C)C)C)OC1 |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/dioscin-collettiside-iii.html |
