Montelukast EP impurity A
ent-Montelukast Sodium Salt (Montelukast EP Impurity A) is the S-enantiomer of Montelukast. Results indicate that there is no apparent bioinversion of Montelukast to its S-enantiomer in humans.
| Catalog Number | CS-O-07943 |
| Alternative Name(s) | S-Montelukast Na; S-motelukast isomer; ent-Montelukast Sodium Salt ; (-) Montelukast sodium Isomer; sodium 2-[1-({[(1S)-1-{3-[(E)-2-(7-chloroquinolin-2- yl)ethenyl]phenyl}-3-[2-(2-hydroxypropan-2- yl)phenyl]propyl]sulfanyl}methyl)cyclopropyl]acetate ; CS-O-11855; CS-O-05826 |
| Molecular Formula | C35H35ClNNaO3S |
| CAS# | 190078-45-6 |
| Purity | >98% |
| SMILES | OC(CC1(CC1)CS[C@H](C2=CC(/C=C/C3=NC4=CC(Cl)=CC=C4C=C3)=CC=C2)CCC(C=CC=C5)=C5C(C)(O)C)=O.[Na] |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO07943.html |
