ABT-080 | MedChemExpress (MCE)
ABT-080 is an orally active inhibitor of leukotriene biosynthesis. ABT-080 simultaneously blocks the leukotriene pathways leading to the synthesis of LTB4 and LTC4, but does not inhibit PGH2 biosynthesis. ABT-080 can block bronchoconstriction and be used in the research of asthma and related inflammations[1]
| Trivial name | ABT-080 |
| Catalog Number | HY-113628 |
| Alternative Name(s) | VML-530 |
| Research Area | Inflammation/Immunology |
| CAS# | 189498-57-5 |
| Purity | ≥98.0% |
| SMILES | O=C(CCC(C)(C1=CC=C(C=C1)OCC2=NC3=CC=CC=C3C=C2)C4=CC=C(C=C4)OCC5=NC6=CC=CC=C6C=C5)O[Na] |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/abt-080.html |