Ozagrel Sodium
Ozagrel is a thromboxane A2 synthase inhibitor used as an antiplatelet agent. It reduces the risk of neurological impairment and the volume of brain damage.
| Catalog Number | API189224268 |
| Alternative Name(s) | 130952-46-4 Cataclot Xanbon |
| Research Area | AnticoagulantAntiplatelet APIs |
| Molecular Formula | C13H11N2NaO2 |
| CAS# | 189224-26-8 |
| SMILES | C1=CC(=CC=C1CN2C=CN=C2)C=CC(=O)[O-].[Na+] |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/ozagrel-sodium-item-12205.html |