Tegaserod Maleate
Tegaserod Maleate(HTF-919) is a hydrogen maleate salt form of tegaserod, which is a 5-HT4 receptor partial agonist and binds with high affinity to 5-HT4 receptors. It has limited affinity for 5-HT1 receptors and no appreciable affinity for other 5-HT receptors, muscarinic, adrenergic, dopaminergic or opiate receptors.
| Trivial name | HTF-919 |
| Catalog Number | S5401 |
| Molecular Formula | C15H10O4 |
| CAS# | 189188-57-6 |
| Inchi | InChI=1S/C15H10O4/c16-10-6-4-9(5-7-10)14-8-12(18)15-11(17)2-1-3-13(15)19-14/h1-8,16-17H |
| Inchi Key | OKRNDQLCMXUCGG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)OC(=CC2=O)C3=CC=C(C=C3)O)O |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/tegaserod-maleate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/tegaserod-maleate-chemical-structure-s5401.gif |
