Tegaserod maleate
API Standard
| Catalog Number | CS-O-02504 |
| Alternative Name(s) | 2-[(5-Methoxy-1H-indol-3-yl)methylene]-N-pentylhydrazinecarboximidamide (2Z)-2-Butenedioate; HTF 919; SDZ-HTF 919; Tegaserod Hydrogen Maleate; Tegibs 6; Zelmac; Zelnorm; |
| Research Area | Tegaserod is a gastroproeinetic used in the treatment of irritable bowel syndrome. A selective serotonin 5HT4-receptor partial agonist. |
| Molecular Formula | C₂₀H₂₇N₅O₅ |
| CAS# | 189188-57-6 |
| Purity | >98% |
| SMILES | OC(/C=CC(O)=O)=O.N=C(NCCCCC)N/N=C/C1=CNC2=C1C=C(OC)C=C2 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02504.html |