Melilotigenin C | MedChemExpress (MCE)
Melilotigenin C can be isolated from genus Erythrina. Melilotigenin C can be used for research on antiplasmodial activity, antimycobacterial activity and cytotoxicity[1].
| Trivial name | Melilotigenin C |
| Catalog Number | HY-N3301 |
| Research Area | Infection |
| CAS# | 188970-21-0 |
| Purity | ≥98.00% |
| SMILES | C[C@]12[C@]3(C([C@@]4([H])[C@](C)([C@@H](CC(C)(C)C4)O)CC3)=CC[C@]1([H])[C@@]5([C@@]([C@](C)(C(CC5)=O)CO)([H])CC2)C)C |
| PubChem Chemical Structure ID | 10551785 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/melilotigenin-c.html |