JTP-103237 | MedChemExpress (MCE)
JTP-103237 is a MGAT2 inhibitor (IC50: 0.019 μM and 6.423 μM for hMGAT2 and hMGAT3 respectively). JTP-103237 modulates fat absorption, decreases plasma glucose levels and prevents diet-induced obesity[1].
| Trivial name | JTP-103237 |
| Catalog Number | HY-135505 |
| Research Area | Metabolic Disease |
| CAS# | 1883864-16-1 |
| Purity | ≥98.00% |
| SMILES | FC(F)(F)OC1=CC=C(C2=NN=C3CN(C4=NC(C(C)(C)C)=CC(C(C)(C)C)=N4)CCN32)C=C1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/jtp-103237.html |