3,5-Diiodotyrosine Dihydrate
3,5-Diiodotyrosine Dihydrate is the substrate for the assay of halogenated tyrosine and thyroid hormone aminotransferase, also the intermediate in the biosynthesis and alternative pathways of thyroid hormones metabolism.
| Trivial name | / |
| Catalog Number | CSN23584 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C9H13I2NO5 |
| CAS# | 18835-59-1 |
| Purity | ≥99% |
| SMILES | O=C(O)[C@@H](N)CC1=CC(I)=C(O)C(I)=C1.[H]O[H].[H]O[H] |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/3,5-diiodotyrosine-dihydrate.html |