Pyridomycin | MedChemExpress (MCE)
Pyridomycin (Erizomycin) is a selective and low cytotoxic inhibitor of Mycobacterium tuberculosis that effectively targets InhA. Pyrdomycin is also an antibiotic that can be obtained from metabolites of Dactylosporangium fulvum. Pyrdomycin can be used in the study of bacterial infections such as tuberculosis[1][2].
| Trivial name | Pyridomycin |
| Catalog Number | HY-111402 |
| Alternative Name(s) | Erizomycin; NSC 246134 |
| Research Area | Infection |
| CAS# | 18791-21-4 |
| Purity | ≥98.0% |
| SMILES | O=C(C1=NC=CC=C1O)N[C@H](C(N[C@@H](CC2=CC=CN=C2)[C@@H](O)[C@H]3C)=O)[C@@H](C)OC(/C(OC3=O)=C(C)/CC)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/pyridomycin.html |