Oseltamivir acid
Oseltamivir acid(GS 4071,Ro 64-0802,Oseltamivir carboxylate), a metabolite of the antiviral compound oseltamivir, acts as a competitive inhibitor of influenza neuraminidases A and influenza neuraminidases B with IC50 of 0.1 to 4.9 nM respectively, thereby preventing virus budding and release.
| Trivial name | GS 4071,Ro 64-0802,Oseltamivir carboxylate |
| Catalog Number | E4607 |
| Molecular Formula | C16H16N4 |
| CAS# | 187227-45-8 |
| SMILES | CC1CCC2=C(C1)C(=C(C(=N2)N)C#N)C3=CN=CC=C3 |
| Size | 1g |
| Supplier Page | http://www.selleckchem.com/products/oseltamivir-acid.html |
| Additional Information | https://file.selleck.cn/downloads/struct/E4607-Oseltamivir-acid-chemical-structure.png |