TAPI-2 2mg
TAPI-2 is an inhibitor of TACE, ADAMs, ACE secretase, and other MMPs (metalloproteinases). TAPI-2 blocks release of DCC7, APP, TNF??, L-selectin, NOTCH, TGF??, IL-6R9, erbB2/HER2, and ACE. This inhibitor has been used in tissue culture.
| Trivial name | TAPI-2 2mg |
| Catalog Number | A14009-2 |
| Alternative Name(s) | N-[2-[2-(hydroxyamino)-2-oxoethyl]-4-methyl-1-oxopentyl]-3-methyl-L-valyl-N-(2-aminoethyl)-L-alaninamide |
| Molecular Formula | C19H37N5O5 |
| CAS# | 187034-31-7 |
| SMILES | C[C@@H](C(=O)NCCN)NC(=O)[C@H](C(C)(C)C)NC(=O)C(CC(C)C)CC(=O)NO |
| Size | 2mg |
| Supplier Page | http://www.adooq.com/tapi-2.html |
