N6-Methyladenosine
N6-Methyladenosine is an abundant nucleoside in cellular mRNA that undergoes demethylation under physiological conditions by fat mass and obesity-associated protein (FTO).
| Trivial name | NSC 29409; 6-Methyladenosine; N-Methyladenosine; M6A |
| Catalog Number | CSN13747 |
| Alternative Name(s) | NSC 29409; 6-Methyladenosine; N-Methyladenosine; M6A |
| Research Area | / |
| Molecular Formula | C11H15N5O4 |
| CAS# | 1867-73-8 |
| Purity | ≥99% |
| SMILES | O[C@@H]1[C@@H](CO)O[C@@H](N2C=NC3=C(NC)N=CN=C23)[C@@H]1O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/n6-methyladenosine.html |