Epothilone C
Epothilone C is an epothilone that is 1-oxacyclohexadec-13-ene-2,6-dione which is substituted by hydroxy groups at positions 4 and 9, methyl groups at positions 5, 5, 7, and 9, and by a (1E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl group at position 16 (the 4S,7R,8S,9S,13Z,16S stereoisomer).
| Catalog Number | MFP-029 |
| Alternative Name(s) | Desoxyepothilone A, UNII-18T00XLN7E, 18T00XLN7E, CHEBI:80029 |
| Molecular Formula | C26H39NO5S |
| CAS# | 186692-73-9 |
| Purity | >95% |
| Inchi | InChI=1S/C26H39NO5S/c1-16-11-9-7-8-10-12-21(17(2)13-20-15-33-19(4)27-20)32-23(29)14-22(28)26(5,6)25(31)18(3)24(16)30/h8,10,13,15-16,18,21-22,24,28,30H,7,9,11-12,14H2,1-6H3/b10-8-,17-13+/t16-,18+,21-,22-,24-/m0/s1 |
| Inchi Key | BEFZAMRWPCMWFJ-QJKGZULSSA-N |
| SMILES | C[C@H]1CCC/C=C\C[C@H](OC(=O)C[C@@H](C(C(=O)[C@@H]([C@H]1O)C)(C)C)O)/C(=C/C2=CSC(=N2)C)/C |
| Size | Inquiry |
| Supplier Page | https://www.creative-peptides.com/product/epothilone-c-item-mfp-029-40606.html |