Roscovitine
Roscovitine is a potent and selective CDK inhibitor for Cdc2, CDK2 and CDK5 with IC50 of 0.65 μM, 0.7 μM and 0.16 μM and shows little effect on CDK4/6.
| Trivial name | CYC202; R-Roscovitine; Seliciclib |
| Catalog Number | CSN11862 |
| Alternative Name(s) | CYC202; R-Roscovitine; Seliciclib |
| Research Area | Cancer |
| Molecular Formula | C19H26N6O |
| CAS# | 186692-46-6 |
| Purity | ≥99% |
| SMILES | CC[C@H](CO)NC1=NC(=C2C(=N1)N(C=N2)C(C)C)NCC3=CC=CC=C3 |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/roscovitine.html |
