LY344864 racemate
LY344864 racemate is the racemate form of LY344864. LY344864 is a selective receptor agonist with an affinity of 6 nM (Ki) at the recently cloned 5-HT1F receptor.
| Trivial name | / |
| Catalog Number | CSN26151 |
| Alternative Name(s) | / |
| Research Area | Neurological Disease |
| Molecular Formula | C21H22FN3O |
| CAS# | 186543-64-6 |
| Purity | ≥98% |
| SMILES | O=C(NC1=CC2=C(NC3=C2CC(N(C)C)CC3)C=C1)C4=CC=C(F)C=C4 |
| Size | 2mg |
| Supplier Page | https://www.csnpharm.com/products/ly-344864-racemate.html |