Alisol B
Alisol B is a natural product isolated and purified from the tubers of Alisma plantago-aquatica Linn. for bone disorders by targeting the differentiation of osteoclasts as well as their functions.
| Trivial name | Alisol-B |
| Catalog Number | CSN13557 |
| Alternative Name(s) | Alisol-B |
| Research Area | / |
| Molecular Formula | C30H48O4 |
| CAS# | 18649-93-9 |
| Purity | ≥98% |
| SMILES | C[C@]([C@@]1(C2=C([C@H](C)C[C@@H]([C@]3([H])C(C)(C)O3)O)CC1)C)(CC[C@@]4([H])C5(C)C)[C@]([C@H](C2)O)([H])[C@]4(CCC5=O)C |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/alisol-b.html |