(-)-Anonaine
(-)-Anonaine can be extracted from several species of Magnoliaceae and Annelidae and has antimalarial, antibacterial, antifungal, antioxidant, anticancer, antidepressant and vasodilatory activities. (-)-Anonaine induces apoptosis in human cervical cancer (HeLa) cells, induces DNA damage and inhibits the growth and migration of human lung cancer h1299 cells through Bax and caspase-dependent pathways.
| Catalog Number | TN1393 |
| Research Area | Microbiology/Virology|||Apoptosis|||oxidation-reduction |
| Molecular Formula | C17H15NO2 |
| CAS# | 1862-41-5 |
| Purity | 99.22% |
| SMILES | C=12C3=C4C(=CC1CCN[C@@]2(CC=5C3=CC=CC5)[H])OCO4 |
| Size | 5 mg |
| Supplier Page | https://www.targetmol.com/compound/(-)-Anonaine |
| Additional Information | https://www.targetmol.com/datasheet/TN1393 |
