AMD 3465
CXCR4 antagonist,potent and selective GPCR/G protein|CXCR
| Catalog Number | B3395-5 |
| Research Area | GPCR/G protein|CXCR |
| Molecular Formula | C24H38N6 |
| CAS# | 185991-24-6 |
| Purity | 98% |
| SMILES | C1CNCCNCCCN(CCNC1)CC2=CC=C(C=C2)CNCC3=CC=CC=N3 |
| Size | 5mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B3395 |
