(S)-Rasagiline
(S)-Rasagiline (TVP1022) is the relatively inactive S-enantiomer form of Rasagiline. Rasagiline is a highly potent selective irreversible MAO inhibitor with IC50s of 4.43 nM and 412 nM for rat brain MAO B and A activity, respectively. (S)-Rasagiline is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
Trivial name | TVP122, S-PAI |
Catalog Number | E4978 |
Molecular Formula | C10H11ClFN5O3 |
CAS# | 185517-74-2 |
Inchi | InChI=1S/C10H11ClFN5O3/c11-10-15-7(13)5-8(16-10)17(2-14-5)9-4(12)6(19)3(1-18)20-9/h2-4,6,9,18-19H,1H2,(H2,13,15,16)/t3-,4+,6-,9-/m1/s1 |
Inchi Key | WDDPHFBMKLOVOX-AYQXTPAHSA-N |
SMILES | C1=NC2=C(N=C(N=C2N1C3C(C(C(O3)CO)O)F)Cl)N |
Size | 25mg |
Supplier Page | http://www.selleckchem.com/products/s-rasagiline.html |
Additional Information | https://file.selleck.cn/downloads/struct/e4978-s-rasagiline-chemical-structure-tube.png |