Acotiamide HCl
Acotiamide HCl is the 2HCl form of acotiamide which is an inhibitor of AChE. It also acts as a prokinetic drug through acetylcholinesterase inhibition and muscarinic receptor antagonism that is used for the treatment of functional dyspepsia.
| Trivial name | / |
| Catalog Number | CSN23387 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C21H31ClN4O5S |
| CAS# | 185104-11-4 |
| Purity | ≥98% |
| SMILES | O=C(C1=CSC(NC(C2=CC(OC)=C(OC)C=C2O)=O)=N1)NCCN(C(C)C)C(C)C.[H]Cl |
| Size | 250mg |
| Supplier Page | https://www.csnpharm.com/products/acotiamide-hcl.html |
