Illudalic acid | MedChemExpress (MCE)
Illudalic acid is a potent and selective Leukocyte antigen-related (LAR) phosphatase inhibitor with an IC50 value of 1.30 µM. Illudalic acid inhibits LAR phosphatase through covalent ligation to the catalytic cysteine residue[1][2].
| Trivial name | Illudalic acid |
| Catalog Number | HY-N12776 |
| Research Area | Cancer |
| CAS# | 18508-77-5 |
| Purity | ≥98.0% |
| SMILES | CC1(CC2=C(C(C=O)=C3CC(OC(C3=C2C1)=O)O)O)C |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/illudalic-acid.html |