Ethyl 3-coumarincarboxylate
Ethyl 3-coumarincarboxylate is a coumarin derivative. Ethyl 3-coumarincarboxylate can be used as a pseudo-template to give a molecularly imprinted polymer (MIP) that has a fairly specific recognition capability for aflatoxins[1].
| Trivial name | / |
| Catalog Number | CSN23539 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C12H10O4 |
| CAS# | 1846-76-0 |
| Purity | ≥98% |
| SMILES | O=C(C(C1=O)=CC2=C(O1)C=CC=C2)OCC |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/ethyl-3-coumarincarboxylate.html |