KLA peptide | MedChemExpress (MCE)
KLA peptide is a biological active peptide. (a cationic amphipathic mitochondrial membrane disrupting peptide that induces programmed cell death by disrupting mitochondrial membrane, but cannot cross the plasma
membrane)
| Trivial name | KLA peptide |
| Catalog Number | HY-P5345 |
| Research Area | Others |
| CAS# | 184240-26-4 |
| Purity | ≥98.00% |
| SMILES | O=C(N[C@@H](CC(C)C)C(N[C@@H](C)C(N[C@@H](CCCCN)C(N[C@@H](CC(C)C)C(N[C@@H](C)C(N[C@@H](CCCCN)C(N[C@@H](CCCCN)C(N[C@@H](CC(C)C)C(N[C@@H](C)C(N[C@@H](CCCCN)C(N[C@@H](CC(C)C)C(N[C@@H](C)C(N[C@@H](CCCCN)C(O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)[C@H](CCCCN)N |
| PubChem Chemical Structure ID | 9855364 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/kla-peptide.html |