Ciproxifan
Histamine H3-receptor antagonist Neuroscience|Histamine Receptor
| Catalog Number | B1570-5 |
| Research Area | Neuroscience|Histamine Receptor |
| Molecular Formula | C16H18N2O2 |
| CAS# | 184025-18-1 |
| Purity | 98% |
| SMILES | C1CC1C(=O)C2=CC=C(C=C2)OCCCC3=CN=CN3 |
| Size | 5mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B1570 |
