Erlotinib HCl
Erlotinib HCl is a directly acting inhibitor of human EGFR tyrosine kinase with an IC50 of 2 nM.
| Trivial name | CP-358774 HCl; OSI 774 HCl; NSC-718781 |
| Catalog Number | CSN16725 |
| Alternative Name(s) | CP-358774 HCl; OSI 774 HCl; NSC-718781 |
| Research Area | Cancer |
| Molecular Formula | C22H24ClN3O4 |
| CAS# | 183319-69-9 |
| Purity | ≥99% |
| SMILES | [H+].C1=C(OCCOC)C(=CC2=NC=NC(=C12)NC3=CC(=CC=C3)C#C)OCCOC.[Cl-] |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/erlotinib-hcl.html |