BTR-1
BTR-1 is a rhodanine derivative induced cytotoxicity in a time- and concentration-dependent manner on leukemic cell line, leading to increased level of ROS production and DNA strand breaks suggesting activation of apoptosis for induction of cell death.
| Trivial name | / |
| Catalog Number | CSN23777 |
| Alternative Name(s) | / |
| Research Area | Cancer |
| Molecular Formula | C12H11NOS2 |
| CAS# | 18331-34-5 |
| Purity | ≥98% |
| SMILES | O=C1N(CC)C(S/C1=C\C2=CC=CC=C2)=S |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/btr-1.html |