Cabazitaxel
Cabazitaxel is a semi-synthetic derivative of the natural taxoid 10-deacetylbaccatin III with potential antineoplastic activity. Cabazitaxel exerts its effects by inhibiting microtubule growth and assembly, processes that are essential for cells to divide and grow.
| Trivial name | RPR-116258A; XRP-6258; TXD-258; Taxoid XRP-6258 |
| Catalog Number | CSN12964 |
| Alternative Name(s) | RPR-116258A; XRP-6258; TXD-258; Taxoid XRP-6258 |
| Research Area | Cancer |
| Molecular Formula | C45H57NO14 |
| CAS# | 183133-96-2 |
| Purity | ≥99% |
| SMILES | O=C(O[C@@H]([C@@]1([H])[C@@]2(C)[C@@H](OC)C[C@@]3([H])OC[C@]31OC(C)=O)[C@]4(O)C[C@H](OC(C(O)C(NC(OC(C)(C)C)=O)C5=CC=CC=C5)=O)C(C)=C(C4(C)C)[C@@H](OC)C2=O)C6=CC=CC=C6 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/cabazitaxel.html |
