Cabazitaxel 10mM * 1mL in DMSO
Cabazitaxel is a semi-synthetic derivative of a natural taxoid. Cabazitaxel in combination with prednisone is a treatment option for hormone-refractory prostate cancer following docetaxel-based treatment
| Trivial name | Cabazitaxel 10mM * 1mL in DMSO |
| Catalog Number | A11831-10mM-D |
| Alternative Name(s) | N/A |
| Molecular Formula | C45H57NO14 |
| CAS# | 183133-96-2 |
| SMILES | CC1=C2[C@H](C(=O)[C@@]3([C@H](C[C@@H]4[C@]([C@H]3[C@@H]([C@@](C2(C)C)(C[C@@H]1OC(=O)[C@@H]([C@H](C5=CC=CC=C5)NC(=O)OC(C)(C)C)O)O)OC(=O)C6=CC=CC=C6)(CO4)OC(=O)C)OC)C)OC |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/cabazitaxel.html |
