Ravuconazole
Ravuconazole is a triazole with antifungal activity. Ravuconazole inhibits 14a demethylase, an enzyme involved in sterol synthesis, resulting in lysis of the fungal cell wall and fungal cell death.
| Catalog Number | API182760061 |
| Alternative Name(s) | ER-30346 BMS-207147 ER 30346 |
| Research Area | Antifungal APIs |
| Molecular Formula | C22H17F2N5OS |
| CAS# | 182760-06-1 |
| SMILES | CC(C1=NC(=CS1)C2=CC=C(C=C2)C#N)C(CN3C=NC=N3)(C4=C(C=C(C=C4)F)F)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/ravuconazole-item-11896.html |