Risdiplam
Risdiplam is an orally bioavailable mRNA splicing modifier used for the treatment of spinal muscular atrophy (SMA). It increases systemic SMN protein concentrations by improving the efficiency of SMN2 gene transcription.
| Catalog Number | API1825352655 |
| Alternative Name(s) | Evrysdi RG7916 RO7034067 |
| Research Area | Anti-muscular Dystrophy APIs |
| Molecular Formula | C22H23N7O |
| CAS# | 1825352-65-5 |
| SMILES | CC1=CC(=NN2C1=NC(=C2)C)C3=CC(=O)N4C=C(C=CC4=N3)N5CCNC6(C5)CC6 |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/risdiplam-item-8113.html |