SB225002 10mg
SB225002 is a potent, and selective CXCR2 antagonist with IC50 of 22 nM for inhibiting interleukin IL-8 binding to CXCR2, > 150-fold selectivity over the other 7-TMRs tested.
| Trivial name | SB225002 10mg |
| Catalog Number | A14209-10 |
| Alternative Name(s) | N-(2-bromophenyl)-N'-(2-hydroxy-4-nitrophenyl)-urea |
| Molecular Formula | C13H10BrN3O4 |
| CAS# | 182498-32-4 |
| SMILES | C1=CC=C(C(=C1)NC(=O)NC2=C(C=C(C=C2)[N+](=O)[O-])O)Br |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/sb225002.html |