T3 (Triiodothyronine)
T3 (Triiodothyronine) is a thyroid hormone that affects various physiological process in the body, including growth and development, metabolism, body temperature, and heart rate.This product is soluble but easy to precipitate after freezing in DMSO. 0.1 M NaOH is recommended as a stock solution.
| Trivial name | 3,3',5-Triiodo-L-thyronine |
| Catalog Number | S5726 |
| Molecular Formula | C22H16F4N6O2 |
| CAS# | 6893-02-3 |
| SMILES | FC1=CC=C(CC2=NNC(=O)C3=C2C=CC=C3)C=C1C(=O)N4CC[N]5N=C(N=C5C4)C(F)(F)F |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/triiodothyronine.html |
| Additional Information | https://file.selleck.cn/downloads/struct/triiodothyronine-chemical-structure-s5726.gif |
