POL1-IN-1
Compound 3A can effectively inhibit the transcription of RNA polymerase I in the A375 malignant melanoma cell line but has no effect on polymerase II.
| Catalog Number | T4356 |
| Alternative Name(s) | Compound 3A |
| Research Area | DNA Damage/DNA Repair|||Cell Cycle/Checkpoint |
| Molecular Formula | C21H20N6 |
| CAS# | 1822358-25-7 |
| Purity | 98.00% |
| SMILES | C[C@H]1CN(C[C@@H](C)N1)c1ccc2cc(C#N)c3nc4ccccc4n3c2n1 |
| Size | 50 mg |
| Supplier Page | https://www.targetmol.com/compound/POL1-IN-1 |
| Additional Information | https://www.targetmol.com/datasheet/T4356 |