KB-R7943 Mesylate
KB-R7943 Mesylate is a potent and selective inhibitor used to reverse mode of the Na+/Ca2+ exchanger with IC50 value of 0.7 μM. It also inhibits the mitochondrial Ca2+ uniporter with IC50 value of 5.5 μM.
| Trivial name | KB R7943 |
| Catalog Number | CSN12367 |
| Alternative Name(s) | KB R7943 |
| Research Area | / |
| Molecular Formula | C17H21N3O6S2 |
| CAS# | 182004-65-5 |
| Purity | ≥99% |
| SMILES | NC(SCCC1=CC=C(OCC2=CC=C([N+]([O-])=O)C=C2)C=C1)=N.CS(=O)(O)=O |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/kb-r7943-mesylate.html |