Almotriptan malate (Axert) 10mM * 1mL in DMSO
Almotriptan malate (Axert) is a selective 5-hydroxytryptamine1B/1D (5-HT1B/1D) receptor agonist, used for the treatment of Migraine attacks in adults.
| Trivial name | Almotriptan malate (Axert) 10mM * 1mL in DMSO |
| Catalog Number | A11799-10mM-D |
| Alternative Name(s) | N,N-Dimethyl-2-[5-(pyrrolidin-1-ylsulfonylmethyl)-1H-indol-3-yl]ethanamine |
| Molecular Formula | C17H25N3O2S.C4H6O5 |
| CAS# | 181183-52-8 |
| SMILES | CN(C)CCC1=CNC2=C1C=C(C=C2)CS(=O)(=O)N3CCCC3.C(C(C(=O)O)O)C(=O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/almotriptan-malate-axert.html |
