2-Amino-5-chlorobenzophenone Oxime
Intermediates
| Trivial name | NULL |
| Catalog Number | CS-T-02287 |
| Alternative Name(s) | (2-Aminome |
| Research Area | Intermediate in the preparation of Chlordiazepoxide and its metabolites. |
| Molecular Formula | C13H11ClN2O |
| CAS# | 18097-52-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O/N=C(C1=CC=CC=C1)C(C=C(Cl)C=C2)=C2N |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST02287.html |
| Additional Information | NULL |