Didehydro Atovaquone
Impurities
| Trivial name | NULL |
| Catalog Number | CS-O-15485 |
| Alternative Name(s) | 2-(4'-chloro-2,3,4,5-tetrahydro-[1,1'-biphenyl]-4-yl)-3-hydroxynaphthalene-1,4-dione; Atovaquone Impurity C . |
| Research Area | Atovaquone Impuriyy C, is the impurity of Atovaquone, which belongs to the class of naphthoquinones, that inhibits mitochondrial electron transport. It is an Antipneumocystic. |
| Molecular Formula | C22H17ClO3 |
| CAS# | 1809464-27-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C1=CC=CC=C1C2=O)C(C3CCC(C4=CC=C(Cl)C=C4)=CC3)=C2O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO15485.html |
| Additional Information | NULL |